octyl octanoate


octyl octanoate
Links:📏 NIST, 🕷 ChemSpider, ⚗️ ChemSynthesis, 📖 PubMed
CAS RN:[2306-88-9]
Formula:C16H32O2; 256.43 g/mol
InChiKey:DJNTZVRUYMHBTD-UHFFFAOYSA-N
SMILES:CCCCCCCCOC(=O)CCCCCCC
Molecular structure of octyl octanoate
Density:0.859 g/mL
Molar volume:298.5 mL/mol
Melting point:-18 °C
Boiling point:307 °C
Log10 partition octanol / water:6.51

Isomers

butyl dodecanoate
Molecular structure of butyl dodecanoate
ethyl tetradecanoate
Molecular structure of ethyl tetradecanoate
heptyl nonanoate
Molecular structure of heptyl nonanoate
hexadecanoic acid
Molecular structure of hexadecanoic acid
2-hexyldecanoic acid
Molecular structure of 2-hexyldecanoic acid
isobutyl dodecanoate
Molecular structure of isobutyl dodecanoate
methyl pentadecanoate
Molecular structure of methyl pentadecanoate
octyl octanoate
Molecular structure of octyl octanoate
tetradecyl acetate
Molecular structure of tetradecyl acetate